C20H19O3PSi — CID 14274429
5,5-dimethyl-11-phenylbenzo[d][1,3,2,6]benzodioxaphosphasilocine 11-oxide (PubChem CID 14274429) has the molecular formula C20H19O3PSi and a molecular weight of 366.43 g/mol. Its IUPAC name is 5,5-dimethyl-11-phenylbenzo[d][1,3,2,6]benzodioxaphosphasilocine 11-oxide.
| Compound Name | 5,5-dimethyl-11-phenylbenzo[d][1,3,2,6]benzodioxaphosphasilocine 11-oxide |
|---|---|
| PubChem CID | 14274429 |
| Molecular Formula | C20H19O3PSi |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 5,5-dimethyl-11-phenylbenzo[d][1,3,2,6]benzodioxaphosphasilocine 11-oxide |
| SMILES | C[Si]1(C)c2ccccc2OP(=O)(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C20H19O3PSi/c1-25(2)19-14-8-6-12-17(19)22-24(21,16-10-4-3-5-11-16)23-18-13-7-9-15-20(18)25/h3-15H,1-2H3 |
| InChIKey | RYRKMMDRWRYFOH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|