About [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate
[2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate (PubChem CID 142744426) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate |
| PubChem CID | 142744426 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate |
| SMILES | CN(C)c1ccc(-c2ncc(COC(=O)NC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-17(2,3)19-16(21)22-11-14-10-18-15(23-14)12-6-8-13(9-7-12)20(4)5/h6-10H,11H2,1-5H3,(H,19,21) |
| InChIKey | YDMFJESGWZSRSO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
The IUPAC name of [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate (CID 142744426) is [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate.
What is the SMILES notation for [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
The canonical SMILES for [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate is CN(C)c1ccc(-c2ncc(COC(=O)NC(C)(C)C)s2)cc1.
What is the InChIKey of [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
The InChIKey is YDMFJESGWZSRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2S/c1-17(2,3)19-16(21)22-11-14-10-18-15(23-14)12-6-8-13(9-7-12)20(4)5/h6-10H,11H2,1-5H3,(H,19,21).
What are the key properties of [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
[2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate has a molecular weight of 333.46 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate is sourced from PubChem (CID 142744426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).