About [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate
[2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate (PubChem CID 142744437) has the molecular formula C18H29N5O2S
and a molecular weight of 379.53 g/mol. Its IUPAC name is [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate |
| PubChem CID | 142744437 |
| Molecular Formula | C18H29N5O2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate |
| SMILES | CN(C)CCCCc1cnn(-c2ncc(COC(=O)NC(C)(C)C)s2)c1 |
| InChI | InChI=1S/C18H29N5O2S/c1-18(2,3)21-17(24)25-13-15-11-19-16(26-15)23-12-14(10-20-23)8-6-7-9-22(4)5/h10-12H,6-9,13H2,1-5H3,(H,21,24) |
| InChIKey | DLLPNNYAEKYTPC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
The IUPAC name of [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate (CID 142744437) is [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate.
What is the SMILES notation for [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
The canonical SMILES for [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate is CN(C)CCCCc1cnn(-c2ncc(COC(=O)NC(C)(C)C)s2)c1.
What is the InChIKey of [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
The InChIKey is DLLPNNYAEKYTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N5O2S/c1-18(2,3)21-17(24)25-13-15-11-19-16(26-15)23-12-14(10-20-23)8-6-7-9-22(4)5/h10-12H,6-9,13H2,1-5H3,(H,21,24).
What are the key properties of [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate?
[2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate has a molecular weight of 379.53 g/mol, XLogP of 3.24, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[4-(dimethylamino)butyl]pyrazol-1-yl]-1,3-thiazol-5-yl]methyl N-tert-butylcarbamate is sourced from PubChem (CID 142744437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).