C24H25N3O3 — CID 142744568
2-[2-(hydroxymethyl)-3-(1-methyl-6-oxo-3-pyridinyl)phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 142744568) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-3-(1-methyl-6-oxo-3-pyridinyl)phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[2-(hydroxymethyl)-3-(1-methyl-6-oxo-3-pyridinyl)phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 142744568 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[2-(hydroxymethyl)-3-(1-methyl-6-oxo-3-pyridinyl)phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | Cn1cc(-c2cccc(N3CCn4c(cc5c4CCCC5)C3=O)c2CO)ccc1=O |
| InChI | InChI=1S/C24H25N3O3/c1-25-14-17(9-10-23(25)29)18-6-4-8-21(19(18)15-28)27-12-11-26-20-7-3-2-5-16(20)13-22(26)24(27)30/h4,6,8-10,13-14,28H,2-3,5,7,11-12,15H2,1H3 |
| InChIKey | FJTITOMTABSEDY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |