C7H12N2O — CID 142744733
4,7-diazaspiro[2.5]octane-4-carbaldehyde (PubChem CID 142744733) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4,7-diazaspiro[2.5]octane-4-carbaldehyde.
| Compound Name | 4,7-diazaspiro[2.5]octane-4-carbaldehyde |
|---|---|
| PubChem CID | 142744733 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4,7-diazaspiro[2.5]octane-4-carbaldehyde |
| SMILES | O=CN1CCNCC12CC2 |
| InChI | InChI=1S/C7H12N2O/c10-6-9-4-3-8-5-7(9)1-2-7/h6,8H,1-5H2 |
| InChIKey | SLMIDVYJQULAQF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|