C14H10Cl2I3NO6 — CID 142745415
[2-[3,5-dicarbonochloridoyl-N-(2-hydroxyethyl)-2,4,6-triiodoanilino]-2-oxoethyl] acetate (PubChem CID 142745415) has the molecular formula C14H10Cl2I3NO6 and a molecular weight of 739.85 g/mol. Its IUPAC name is [2-[3,5-dicarbonochloridoyl-N-(2-hydroxyethyl)-2,4,6-triiodoanilino]-2-oxoethyl] acetate.
| Compound Name | [2-[3,5-dicarbonochloridoyl-N-(2-hydroxyethyl)-2,4,6-triiodoanilino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 142745415 |
| Molecular Formula | C14H10Cl2I3NO6 |
| Molecular Weight | 739.85 g/mol |
| Exact Mass | 738.70 |
| IUPAC Name | [2-[3,5-dicarbonochloridoyl-N-(2-hydroxyethyl)-2,4,6-triiodoanilino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N(CCO)c1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C14H10Cl2I3NO6/c1-5(22)26-4-6(23)20(2-3-21)12-10(18)7(13(15)24)9(17)8(11(12)19)14(16)25/h21H,2-4H2,1H3 |
| InChIKey | OWMPAXOSKIZIAA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|