C18H26N6O4S — CID 142745927
N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]methanesulfonamide (PubChem CID 142745927) has the molecular formula C18H26N6O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]methanesulfonamide.
| Compound Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]methanesulfonamide |
|---|---|
| PubChem CID | 142745927 |
| Molecular Formula | C18H26N6O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]methanesulfonamide |
| SMILES | COCCOc1ccc2c(c1)nc(NCCCCNS(C)(=O)=O)c1nnc(C)n12 |
| InChI | InChI=1S/C18H26N6O4S/c1-13-22-23-18-17(19-8-4-5-9-20-29(3,25)26)21-15-12-14(28-11-10-27-2)6-7-16(15)24(13)18/h6-7,12,20H,4-5,8-11H2,1-3H3,(H,19,21) |
| InChIKey | YKDCSUSCSRBZGX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|