C23H25FN6O3 — CID 142746070
N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-fluorobenzamide (PubChem CID 142746070) has the molecular formula C23H25FN6O3 and a molecular weight of 452.49 g/mol. Its IUPAC name is N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 142746070 |
| Molecular Formula | C23H25FN6O3 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-fluorobenzamide |
| SMILES | COc1cc2nc(NCCCCNC(=O)c3ccccc3F)c3nnc(C)n3c2cc1OC |
| InChI | InChI=1S/C23H25FN6O3/c1-14-28-29-22-21(27-17-12-19(32-2)20(33-3)13-18(17)30(14)22)25-10-6-7-11-26-23(31)15-8-4-5-9-16(15)24/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3,(H,25,27)(H,26,31) |
| InChIKey | WLTOGDWCXHFAQC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|