C21H22N6O — CID 142746158
N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide (PubChem CID 142746158) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide.
| Compound Name | N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 142746158 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide |
| SMILES | Cc1nnc2c(NCCCCNC(=O)c3ccccc3)nc3ccccc3n12 |
| InChI | InChI=1S/C21H22N6O/c1-15-25-26-20-19(24-17-11-5-6-12-18(17)27(15)20)22-13-7-8-14-23-21(28)16-9-3-2-4-10-16/h2-6,9-12H,7-8,13-14H2,1H3,(H,22,24)(H,23,28) |
| InChIKey | WPISLGBRKJFEFJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|