C21H22FN7O — CID 142746174
1-[4-[(8-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-phenylurea (PubChem CID 142746174) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is 1-[4-[(8-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-phenylurea.
| Compound Name | 1-[4-[(8-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-phenylurea |
|---|---|
| PubChem CID | 142746174 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-[4-[(8-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-phenylurea |
| SMILES | Cc1nnc2c(NCCCCNC(=O)Nc3ccccc3)nc3ccc(F)cc3n12 |
| InChI | InChI=1S/C21H22FN7O/c1-14-27-28-20-19(26-17-10-9-15(22)13-18(17)29(14)20)23-11-5-6-12-24-21(30)25-16-7-3-2-4-8-16/h2-4,7-10,13H,5-6,11-12H2,1H3,(H,23,26)(H2,24,25,30) |
| InChIKey | VRGONNWNQKAZDP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|