C19H26N6O2 — CID 142746243
tert-butyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate (PubChem CID 142746243) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 142746243 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | tert-butyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
| SMILES | Cc1nnc2c(NCCCCNC(=O)OC(C)(C)C)nc3ccccc3n12 |
| InChI | InChI=1S/C19H26N6O2/c1-13-23-24-17-16(22-14-9-5-6-10-15(14)25(13)17)20-11-7-8-12-21-18(26)27-19(2,3)4/h5-6,9-10H,7-8,11-12H2,1-4H3,(H,20,22)(H,21,26) |
| InChIKey | MFTRLHOLYPZODT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|