C14H21Cl3N4O — CID 142746476
(2R,3S)-2-[3-(6-chloroimidazo[4,5-c]pyridin-1-yl)propyl]piperidin-3-ol;dihydrochloride (PubChem CID 142746476) has the molecular formula C14H21Cl3N4O and a molecular weight of 367.71 g/mol. Its IUPAC name is (2R,3S)-2-[3-(6-chloroimidazo[4,5-c]pyridin-1-yl)propyl]piperidin-3-ol;dihydrochloride.
| Compound Name | (2R,3S)-2-[3-(6-chloroimidazo[4,5-c]pyridin-1-yl)propyl]piperidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 142746476 |
| Molecular Formula | C14H21Cl3N4O |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2R,3S)-2-[3-(6-chloroimidazo[4,5-c]pyridin-1-yl)propyl]piperidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.O[C@H]1CCCN[C@@H]1CCCn1cnc2cnc(Cl)cc21 |
| InChI | InChI=1S/C14H19ClN4O.2ClH/c15-14-7-12-11(8-17-14)18-9-19(12)6-2-3-10-13(20)4-1-5-16-10;;/h7-10,13,16,20H,1-6H2;2*1H/t10-,13+;;/m1../s1 |
| InChIKey | UVSSFMUVVXYERX-SRSVFUAYSA-N |
| XLogP | 2.82 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|