About 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one
2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one (PubChem CID 142746798) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one |
| PubChem CID | 142746798 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one |
| SMILES | Cc1cc(-c2nc3ccccc3c(=O)[nH]2)cc(C)c1O |
| InChI | InChI=1S/C16H14N2O2/c1-9-7-11(8-10(2)14(9)19)15-17-13-6-4-3-5-12(13)16(20)18-15/h3-8,19H,1-2H3,(H,17,18,20) |
| InChIKey | PNEAZXMMTNBIOB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
The IUPAC name of 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one (CID 142746798) is 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one.
What is the SMILES notation for 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
The canonical SMILES for 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one is Cc1cc(-c2nc3ccccc3c(=O)[nH]2)cc(C)c1O.
What is the InChIKey of 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
The InChIKey is PNEAZXMMTNBIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c1-9-7-11(8-10(2)14(9)19)15-17-13-6-4-3-5-12(13)16(20)18-15/h3-8,19H,1-2H3,(H,17,18,20).
What are the key properties of 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one has a molecular weight of 266.30 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one is sourced from PubChem (CID 142746798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).