C17H26N+ — CID 1427474
(1S,5S)-1,5-dimethylspiro[1,2,4,5-tetrahydro-2-benzazepin-2-ium-3,1'-cyclohexane] (PubChem CID 1427474) has the molecular formula C17H26N+ and a molecular weight of 244.40 g/mol. Its IUPAC name is (1S,5S)-1,5-dimethylspiro[1,2,4,5-tetrahydro-2-benzazepin-2-ium-3,1'-cyclohexane].
| Compound Name | (1S,5S)-1,5-dimethylspiro[1,2,4,5-tetrahydro-2-benzazepin-2-ium-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 1427474 |
| Molecular Formula | C17H26N+ |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | (1S,5S)-1,5-dimethylspiro[1,2,4,5-tetrahydro-2-benzazepin-2-ium-3,1'-cyclohexane] |
| SMILES | C[C@@H]1[NH2+]C2(CCCCC2)C[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C17H25N/c1-13-12-17(10-6-3-7-11-17)18-14(2)16-9-5-4-8-15(13)16/h4-5,8-9,13-14,18H,3,6-7,10-12H2,1-2H3/p+1/t13-,14-/m0/s1 |
| InChIKey | MLKXKMPAUIUUOA-KBPBESRZSA-O |
| XLogP | 3.52 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |