About 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine
4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine (PubChem CID 142747429) has the molecular formula C15H15Cl2NO2
and a molecular weight of 312.20 g/mol. Its IUPAC name is 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine |
| PubChem CID | 142747429 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine |
| SMILES | Clc1ccc(-c2ccc(CN3CCOCC3)o2)cc1Cl |
| InChI | InChI=1S/C15H15Cl2NO2/c16-13-3-1-11(9-14(13)17)15-4-2-12(20-15)10-18-5-7-19-8-6-18/h1-4,9H,5-8,10H2 |
| InChIKey | UYOMCGBXDSPZLN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine?
The IUPAC name of 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine (CID 142747429) is 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine is Clc1ccc(-c2ccc(CN3CCOCC3)o2)cc1Cl.
What is the InChIKey of 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine?
The InChIKey is UYOMCGBXDSPZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2NO2/c16-13-3-1-11(9-14(13)17)15-4-2-12(20-15)10-18-5-7-19-8-6-18/h1-4,9H,5-8,10H2.
What are the key properties of 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine?
4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine has a molecular weight of 312.20 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]morpholine is sourced from PubChem (CID 142747429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).