About 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride
7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride (PubChem CID 14274774) has the molecular formula C14H14ClN3S
and a molecular weight of 291.81 g/mol. Its IUPAC name is 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride |
| PubChem CID | 14274774 |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride |
| SMILES | Cl.[H]/N=c1\ccc2nc3ccc(N(C)C)cc3sc-2c1 |
| InChI | InChI=1S/C14H13N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8,15H,1-2H3;1H/b15-9+; |
| InChIKey | NALREUIWICQLPS-NSPIFIKESA-N |
| XLogP | 3.37 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride?
The IUPAC name of 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride (CID 14274774) is 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride.
What is the SMILES notation for 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride?
The canonical SMILES for 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride is Cl.[H]/N=c1\ccc2nc3ccc(N(C)C)cc3sc-2c1.
What is the InChIKey of 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride?
The InChIKey is NALREUIWICQLPS-NSPIFIKESA-N. The full InChI is InChI=1S/C14H13N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8,15H,1-2H3;1H/b15-9+;.
What are the key properties of 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride?
7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride has a molecular weight of 291.81 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-imino-N,N-dimethylphenothiazin-3-amine;hydrochloride is sourced from PubChem (CID 14274774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).