C25H32ClN7O2 — CID 142747794
2-chloro-9-(2-piperidin-4-ylethyl)-8-[(6-pyrrolidin-1-yl-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]purin-6-amine (PubChem CID 142747794) has the molecular formula C25H32ClN7O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 2-chloro-9-(2-piperidin-4-ylethyl)-8-[(6-pyrrolidin-1-yl-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]purin-6-amine.
| Compound Name | 2-chloro-9-(2-piperidin-4-ylethyl)-8-[(6-pyrrolidin-1-yl-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 142747794 |
| Molecular Formula | C25H32ClN7O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-chloro-9-(2-piperidin-4-ylethyl)-8-[(6-pyrrolidin-1-yl-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]purin-6-amine |
| SMILES | Nc1nc(Cl)nc2c1nc(Cc1cc3c(cc1N1CCCC1)OCCO3)n2CCC1CCNCC1 |
| InChI | InChI=1S/C25H32ClN7O2/c26-25-30-23(27)22-24(31-25)33(10-5-16-3-6-28-7-4-16)21(29-22)14-17-13-19-20(35-12-11-34-19)15-18(17)32-8-1-2-9-32/h13,15-16,28H,1-12,14H2,(H2,27,30,31) |
| InChIKey | AMZCNWPARGLFPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|