C29H38O4 — CID 142747864
bis(1,6-diethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 142747864) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is bis(1,6-diethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(1,6-diethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142747864 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | bis(1,6-diethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCC1C=CC=CC1(CC)OC(=O)C1C2C=CC(C2)C1C(=O)OC1(CC)C=CC=CC1CC |
| InChI | InChI=1S/C29H38O4/c1-5-22-13-9-11-17-28(22,7-3)32-26(30)24-20-15-16-21(19-20)25(24)27(31)33-29(8-4)18-12-10-14-23(29)6-2/h9-18,20-25H,5-8,19H2,1-4H3 |
| InChIKey | ZAGVJUZKUOWDDJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|