C29H36O4 — CID 142747967
bis(1,4,6-trimethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142747967) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is bis(1,4,6-trimethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis(1,4,6-trimethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142747967 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | bis(1,4,6-trimethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CC1=CC(C)C(C)(OC(=O)C2=C(C(=O)OC3(C)C=CC(C)=CC3C)C3C=CC2C3(C)C)C=C1 |
| InChI | InChI=1S/C29H36O4/c1-17-11-13-28(7,19(3)15-17)32-25(30)23-21-9-10-22(27(21,5)6)24(23)26(31)33-29(8)14-12-18(2)16-20(29)4/h9-16,19-22H,1-8H3 |
| InChIKey | UKTVSWAJAFIBNM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|