C25H28O4 — CID 142748234
bis(1,3-dimethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142748234) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is bis(1,3-dimethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis(1,3-dimethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748234 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | bis(1,3-dimethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CC1=CC(C)(OC(=O)C2=C(C(=O)OC3(C)C=C(C)C=CC3)C3C=CC2C3)CC=C1 |
| InChI | InChI=1S/C25H28O4/c1-16-7-5-11-24(3,14-16)28-22(26)20-18-9-10-19(13-18)21(20)23(27)29-25(4)12-6-8-17(2)15-25/h5-10,14-15,18-19H,11-13H2,1-4H3 |
| InChIKey | MCOXKZGAMADSHV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|