C28H28N4O — CID 142748257
4-[3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-methyl-1H-cinnolin-8-yl]benzonitrile (PubChem CID 142748257) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-methyl-1H-cinnolin-8-yl]benzonitrile.
| Compound Name | 4-[3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-methyl-1H-cinnolin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 142748257 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-methyl-1H-cinnolin-8-yl]benzonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C3=Cc4cccc(-c5ccc(C#N)cc5)c4NN3C)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C28H28N4O/c1-19-17-32(18-20(2)33-19)25-13-11-23(12-14-25)27-15-24-5-4-6-26(28(24)30-31(27)3)22-9-7-21(16-29)8-10-22/h4-15,19-20,30H,17-18H2,1-3H3/t19-,20+ |
| InChIKey | PBJPUPOFTYFRAB-BGYRXZFFSA-N |
| XLogP | 5.61 |
| TPSA | 51.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|