C51H69N3O12 — CID 14274831
2-[3,5-bis[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (PubChem CID 14274831) has the molecular formula C51H69N3O12 and a molecular weight of 916.12 g/mol. Its IUPAC name is 2-[3,5-bis[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate.
| Compound Name | 2-[3,5-bis[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 14274831 |
| Molecular Formula | C51H69N3O12 |
| Molecular Weight | 916.12 g/mol |
| Exact Mass | 915.49 |
| IUPAC Name | 2-[3,5-bis[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)OCCn2c(=O)n(CCOC(=O)CCc3cc(C)c(O)c(C(C)(C)C)c3)c(=O)n(CCOC(=O)CCc3cc(C)c(O)c(C(C)(C)C)c3)c2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C51H69N3O12/c1-31-25-34(28-37(43(31)58)49(4,5)6)13-16-40(55)64-22-19-52-46(61)53(20-23-65-41(56)17-14-35-26-32(2)44(59)38(29-35)50(7,8)9)48(63)54(47(52)62)21-24-66-42(57)18-15-36-27-33(3)45(60)39(30-36)51(10,11)12/h25-30,58-60H,13-24H2,1-12H3 |
| InChIKey | BBRFYTKXXGZJDT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 205.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.12 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|