About 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide
7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 142749010) has the molecular formula C8H8F2N4O
and a molecular weight of 214.18 g/mol. Its IUPAC name is 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| PubChem CID | 142749010 |
| Molecular Formula | C8H8F2N4O |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1cnn2c1NCC=C2C(F)F |
| InChI | InChI=1S/C8H8F2N4O/c9-6(10)5-1-2-12-8-4(7(11)15)3-13-14(5)8/h1,3,6,12H,2H2,(H2,11,15) |
| InChIKey | UMJGYDUNZAEWAW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide?
The IUPAC name of 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide (CID 142749010) is 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
What is the SMILES notation for 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide?
The canonical SMILES for 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide is NC(=O)c1cnn2c1NCC=C2C(F)F.
What is the InChIKey of 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide?
The InChIKey is UMJGYDUNZAEWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N4O/c9-6(10)5-1-2-12-8-4(7(11)15)3-13-14(5)8/h1,3,6,12H,2H2,(H2,11,15).
What are the key properties of 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide?
7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide has a molecular weight of 214.18 g/mol, XLogP of 0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(difluoromethyl)-4,5-dihydropyrazolo[1,5-a]pyrimidine-3-carboxamide is sourced from PubChem (CID 142749010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).