C18H19FN4O3S — CID 142749646
N-[5-(3-fluorophenyl)sulfonyl-2H-pyrazolo[3,4-b]pyridin-3-yl]hexanamide (PubChem CID 142749646) has the molecular formula C18H19FN4O3S and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)sulfonyl-2H-pyrazolo[3,4-b]pyridin-3-yl]hexanamide.
| Compound Name | N-[5-(3-fluorophenyl)sulfonyl-2H-pyrazolo[3,4-b]pyridin-3-yl]hexanamide |
|---|---|
| PubChem CID | 142749646 |
| Molecular Formula | C18H19FN4O3S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[5-(3-fluorophenyl)sulfonyl-2H-pyrazolo[3,4-b]pyridin-3-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1[nH]nc2ncc(S(=O)(=O)c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C18H19FN4O3S/c1-2-3-4-8-16(24)21-18-15-10-14(11-20-17(15)22-23-18)27(25,26)13-7-5-6-12(19)9-13/h5-7,9-11H,2-4,8H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | CXGLOCBJICXMCK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|