About ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate
ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate (PubChem CID 142749732) has the molecular formula C19H15Cl2NO2
and a molecular weight of 360.24 g/mol. Its IUPAC name is ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate |
| PubChem CID | 142749732 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(/C=C/c2ccc(Cl)c(Cl)c2)n2ccccc12 |
| InChI | InChI=1S/C19H15Cl2NO2/c1-2-24-19(23)15-12-14(22-10-4-3-5-18(15)22)8-6-13-7-9-16(20)17(21)11-13/h3-12H,2H2,1H3/b8-6+ |
| InChIKey | KMDRBVQPNYZXJO-SOFGYWHQSA-N |
| XLogP | 5.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate?
The IUPAC name of ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate (CID 142749732) is ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate.
What is the SMILES notation for ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate?
The canonical SMILES for ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate is CCOC(=O)c1cc(/C=C/c2ccc(Cl)c(Cl)c2)n2ccccc12.
What is the InChIKey of ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate?
The InChIKey is KMDRBVQPNYZXJO-SOFGYWHQSA-N. The full InChI is InChI=1S/C19H15Cl2NO2/c1-2-24-19(23)15-12-14(22-10-4-3-5-18(15)22)8-6-13-7-9-16(20)17(21)11-13/h3-12H,2H2,1H3/b8-6+.
What are the key properties of ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate?
ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate has a molecular weight of 360.24 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]indolizine-1-carboxylate is sourced from PubChem (CID 142749732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).