About [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate
[6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 142749798) has the molecular formula C18H10F3NO3S2
and a molecular weight of 409.41 g/mol. Its IUPAC name is [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| PubChem CID | 142749798 |
| Molecular Formula | C18H10F3NO3S2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2cc(-c3nc4ccccc4s3)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C18H10F3NO3S2/c19-18(20,21)27(23,24)25-14-8-7-11-9-13(6-5-12(11)10-14)17-22-15-3-1-2-4-16(15)26-17/h1-10H |
| InChIKey | FDTDHQFOCKLLQG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The IUPAC name of [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate (CID 142749798) is [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc2cc(-c3nc4ccccc4s3)ccc2c1)C(F)(F)F.
What is the InChIKey of [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The InChIKey is FDTDHQFOCKLLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3NO3S2/c19-18(20,21)27(23,24)25-14-8-7-11-9-13(6-5-12(11)10-14)17-22-15-3-1-2-4-16(15)26-17/h1-10H.
What are the key properties of [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate?
[6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate has a molecular weight of 409.41 g/mol, XLogP of 5.34, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,3-benzothiazol-2-yl)naphthalen-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 142749798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).