C32H54 — CID 14274988
(6E,11E,16E)-10-ethenyl-2,3,6,10,13,17,20,21-octamethyldocosa-1,6,11,16,21-pentaene (PubChem CID 14274988) has the molecular formula C32H54 and a molecular weight of 438.78 g/mol. Its IUPAC name is (6E,11E,16E)-10-ethenyl-2,3,6,10,13,17,20,21-octamethyldocosa-1,6,11,16,21-pentaene.
| Compound Name | (6E,11E,16E)-10-ethenyl-2,3,6,10,13,17,20,21-octamethyldocosa-1,6,11,16,21-pentaene |
|---|---|
| PubChem CID | 14274988 |
| Molecular Formula | C32H54 |
| Molecular Weight | 438.78 g/mol |
| Exact Mass | 438.42 |
| IUPAC Name | (6E,11E,16E)-10-ethenyl-2,3,6,10,13,17,20,21-octamethyldocosa-1,6,11,16,21-pentaene |
| SMILES | C=CC(C)(/C=C/C(C)CC/C=C(\C)CCC(C)C(=C)C)CC/C=C(\C)CCC(C)C(=C)C |
| InChI | InChI=1S/C32H54/c1-12-32(11,23-14-17-28(7)19-21-31(10)26(4)5)24-22-29(8)16-13-15-27(6)18-20-30(9)25(2)3/h12,15,17,22,24,29-31H,1-2,4,13-14,16,18-21,23H2,3,5-11H3/b24-22+,27-15+,28-17+ |
| InChIKey | YIERDWVPDSIPLW-PTFXNVDKSA-N |
| XLogP | 10.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.78 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|