About (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile
(E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile (PubChem CID 142750585) has the molecular formula C9H6N4
and a molecular weight of 170.17 g/mol. Its IUPAC name is (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile.
Molecular Properties
| Compound Name | (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile |
| PubChem CID | 142750585 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(\CC)C(C#N)C#N |
| InChI | InChI=1S/C9H6N4/c1-3-8(7(4-10)5-11)9(6-12)13-2/h7H,3H2,1H3/b9-8+ |
| InChIKey | VHOSWBPGFVOXPC-CMDGGOBGSA-N |
| XLogP | 1.76 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile?
The IUPAC name of (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile (CID 142750585) is (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile.
What is the SMILES notation for (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile?
The canonical SMILES for (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile is [C-]#[N+]/C(C#N)=C(\CC)C(C#N)C#N.
What is the InChIKey of (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile?
The InChIKey is VHOSWBPGFVOXPC-CMDGGOBGSA-N. The full InChI is InChI=1S/C9H6N4/c1-3-8(7(4-10)5-11)9(6-12)13-2/h7H,3H2,1H3/b9-8+.
What are the key properties of (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile?
(E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile has a molecular weight of 170.17 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethyl-3-isocyanoprop-2-ene-1,1,3-tricarbonitrile is sourced from PubChem (CID 142750585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).