C15H12ClFN4O3 — CID 142750756
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitro-1,4-dihydroquinazolin-4-amine (PubChem CID 142750756) has the molecular formula C15H12ClFN4O3 and a molecular weight of 350.74 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitro-1,4-dihydroquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitro-1,4-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 142750756 |
| Molecular Formula | C15H12ClFN4O3 |
| Molecular Weight | 350.74 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-nitro-1,4-dihydroquinazolin-4-amine |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C(Nc1ccc(F)c(Cl)c1)N=CN2 |
| InChI | InChI=1S/C15H12ClFN4O3/c1-24-14-6-12-9(5-13(14)21(22)23)15(19-7-18-12)20-8-2-3-11(17)10(16)4-8/h2-7,15,20H,1H3,(H,18,19) |
| InChIKey | VQMJKMRMDRSNFQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|