C31H27F9N8O — CID 142751237
1-[7-[[2-[3,5-bis(trifluoromethyl)anilino]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-4-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 142751237) has the molecular formula C31H27F9N8O and a molecular weight of 698.59 g/mol. Its IUPAC name is 1-[7-[[2-[3,5-bis(trifluoromethyl)anilino]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-4-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-[[2-[3,5-bis(trifluoromethyl)anilino]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-4-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 142751237 |
| Molecular Formula | C31H27F9N8O |
| Molecular Weight | 698.59 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 1-[7-[[2-[3,5-bis(trifluoromethyl)anilino]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-4-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCc2ccc(Nc3nc(Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)ncc3-c3cnn(C4CCNCC4)c3)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C31H27F9N8O/c32-29(33,34)20-10-21(30(35,36)37)12-23(11-20)45-28-42-14-25(19-13-43-48(16-19)24-3-6-41-7-4-24)26(46-28)44-22-2-1-17-5-8-47(15-18(17)9-22)27(49)31(38,39)40/h1-2,9-14,16,24,41H,3-8,15H2,(H2,42,44,45,46) |
| InChIKey | VFMVCUUGAQQISJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |