About 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol
4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol (PubChem CID 142751444) has the molecular formula C46H37N3O2
and a molecular weight of 663.82 g/mol. Its IUPAC name is 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol.
Molecular Properties
| Compound Name | 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol |
| PubChem CID | 142751444 |
| Molecular Formula | C46H37N3O2 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1cc(N(c2ccc(O)cc2)c2ccc(O)cc2)cc(-n2c3ccc(C)cc3c3cc(C)ccc32)c1 |
| InChI | InChI=1S/C46H37N3O2/c1-28-5-17-43-39(21-28)40-22-29(2)6-18-44(40)48(43)35-25-34(47(32-9-13-37(50)14-10-32)33-11-15-38(51)16-12-33)26-36(27-35)49-45-19-7-30(3)23-41(45)42-24-31(4)8-20-46(42)49/h5-27,50-51H,1-4H3 |
| InChIKey | IQPADFUMPKYODS-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 53.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol?
The IUPAC name of 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol (CID 142751444) is 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol.
What is the SMILES notation for 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol?
The canonical SMILES for 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol is Cc1ccc2c(c1)c1cc(C)ccc1n2-c1cc(N(c2ccc(O)cc2)c2ccc(O)cc2)cc(-n2c3ccc(C)cc3c3cc(C)ccc32)c1.
What is the InChIKey of 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol?
The InChIKey is IQPADFUMPKYODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H37N3O2/c1-28-5-17-43-39(21-28)40-22-29(2)6-18-44(40)48(43)35-25-34(47(32-9-13-37(50)14-10-32)33-11-15-38(51)16-12-33)26-36(27-35)49-45-19-7-30(3)23-41(45)42-24-31(4)8-20-46(42)49/h5-27,50-51H,1-4H3.
What are the key properties of 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol?
4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol has a molecular weight of 663.82 g/mol, XLogP of 12.00, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N-[3,5-bis(3,6-dimethylcarbazol-9-yl)phenyl]-4-hydroxyanilino)phenol is sourced from PubChem (CID 142751444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).