C32H42F3N7O3Si — CID 142751827
tert-butyl (3S)-3-[[5-(trifluoromethyl)-4-[6-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-1H-indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 142751827) has the molecular formula C32H42F3N7O3Si and a molecular weight of 657.81 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[5-(trifluoromethyl)-4-[6-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-1H-indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[5-(trifluoromethyl)-4-[6-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-1H-indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142751827 |
| Molecular Formula | C32H42F3N7O3Si |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | tert-butyl (3S)-3-[[5-(trifluoromethyl)-4-[6-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-1H-indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Nc2ncc(C(F)(F)F)c(-c3c[nH]c4cc(-c5nccn5COCC[Si](C)(C)C)ccc34)n2)C1 |
| InChI | InChI=1S/C32H42F3N7O3Si/c1-31(2,3)45-30(43)41-12-7-8-22(19-41)39-29-38-18-25(32(33,34)35)27(40-29)24-17-37-26-16-21(9-10-23(24)26)28-36-11-13-42(28)20-44-14-15-46(4,5)6/h9-11,13,16-18,22,37H,7-8,12,14-15,19-20H2,1-6H3,(H,38,39,40)/t22-/m0/s1 |
| InChIKey | APDVMYUQASGEPK-QFIPXVFZSA-N |
| XLogP | 7.63 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|