C24H30N4O2 — CID 142751927
2-[[4-[4-(propan-2-yloxymethyl)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 142751927) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[[4-[4-(propan-2-yloxymethyl)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-[[4-[4-(propan-2-yloxymethyl)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142751927 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[[4-[4-(propan-2-yloxymethyl)piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CC(C)OCC1CCN(c2ccc(Cc3nc4ccccn4c3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O2/c1-17(2)30-16-19-10-13-27(14-11-19)20-8-6-18(7-9-20)15-21-23(24(25)29)28-12-4-3-5-22(28)26-21/h3-9,12,17,19H,10-11,13-16H2,1-2H3,(H2,25,29) |
| InChIKey | ZCKNTLWUSYQAHK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|