C16H11BO2S — CID 142752829
naphtho[1,2-b][1]benzothiol-9-ylboronic acid (PubChem CID 142752829) has the molecular formula C16H11BO2S and a molecular weight of 278.14 g/mol. Its IUPAC name is naphtho[1,2-b][1]benzothiol-9-ylboronic acid.
| Compound Name | naphtho[1,2-b][1]benzothiol-9-ylboronic acid |
|---|---|
| PubChem CID | 142752829 |
| Molecular Formula | C16H11BO2S |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | naphtho[1,2-b][1]benzothiol-9-ylboronic acid |
| SMILES | OB(O)c1ccc2c(c1)sc1c3ccccc3ccc21 |
| InChI | InChI=1S/C16H11BO2S/c18-17(19)11-6-8-13-14-7-5-10-3-1-2-4-12(10)16(14)20-15(13)9-11/h1-9,18-19H |
| InChIKey | WVTSVRGATJWTJS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|