C46H54Si2 — CID 142753386
[2-(4-tert-butyl-2-cyclopropylphenyl)-1H-inden-1-yl]-[2-(4-tert-butyl-2-methylphenyl)-1H-inden-1-yl]-diethylsilylidenesilane (PubChem CID 142753386) has the molecular formula C46H54Si2 and a molecular weight of 663.11 g/mol. Its IUPAC name is [2-(4-tert-butyl-2-cyclopropylphenyl)-1H-inden-1-yl]-[2-(4-tert-butyl-2-methylphenyl)-1H-inden-1-yl]-diethylsilylidenesilane.
| Compound Name | [2-(4-tert-butyl-2-cyclopropylphenyl)-1H-inden-1-yl]-[2-(4-tert-butyl-2-methylphenyl)-1H-inden-1-yl]-diethylsilylidenesilane |
|---|---|
| PubChem CID | 142753386 |
| Molecular Formula | C46H54Si2 |
| Molecular Weight | 663.11 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | [2-(4-tert-butyl-2-cyclopropylphenyl)-1H-inden-1-yl]-[2-(4-tert-butyl-2-methylphenyl)-1H-inden-1-yl]-diethylsilylidenesilane |
| SMILES | CC[Si](CC)=[Si](C1C(c2ccc(C(C)(C)C)cc2C)=Cc2ccccc21)C1C(c2ccc(C(C)(C)C)cc2C2CC2)=Cc2ccccc21 |
| InChI | InChI=1S/C46H54Si2/c1-10-47(11-2)48(43-37-18-14-12-16-32(37)27-41(43)36-24-22-34(26-30(36)3)45(4,5)6)44-38-19-15-13-17-33(38)28-42(44)39-25-23-35(46(7,8)9)29-40(39)31-20-21-31/h12-19,22-29,31,43-44H,10-11,20-21H2,1-9H3 |
| InChIKey | AVLOMCLLHHEJLD-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.11 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|