C22H18F2N4O5 — CID 142753557
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-methylpyrazole-4-carboxamide (PubChem CID 142753557) has the molecular formula C22H18F2N4O5 and a molecular weight of 456.41 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142753557 |
| Molecular Formula | C22H18F2N4O5 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c(-c2cccc3c2OC(F)(F)O3)n1 |
| InChI | InChI=1S/C22H18F2N4O5/c1-28-11-14(17(27-28)13-8-5-9-16-19(13)33-22(23,24)32-16)21(31)26-15(18(29)20(25)30)10-12-6-3-2-4-7-12/h2-9,11,15H,10H2,1H3,(H2,25,30)(H,26,31) |
| InChIKey | BUCMEGDXUOLTJR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|