C25H23N5O4 — CID 142753570
1-methyl-N-[(2S)-4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylpyrazole-4-carboxamide (PubChem CID 142753570) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 1-methyl-N-[(2S)-4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylpyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[(2S)-4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142753570 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-methyl-N-[(2S)-4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(=O)NCc2ncco2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H23N5O4/c1-30-16-19(22(29-30)18-10-6-3-7-11-18)24(32)28-20(14-17-8-4-2-5-9-17)23(31)25(33)27-15-21-26-12-13-34-21/h2-13,16,20H,14-15H2,1H3,(H,27,33)(H,28,32)/t20-/m0/s1 |
| InChIKey | HBAIYGJUJIUCRD-FQEVSTJZSA-N |
| XLogP | 2.30 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|