C43H46Cl2N14O5 — CID 142754266
1,3-bis(2-chlorophenyl)-1,3-bis[4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)amino]-6-(4-methylpiperazin-1-yl)-3-pyridinyl]propan-2-one (PubChem CID 142754266) has the molecular formula C43H46Cl2N14O5 and a molecular weight of 909.84 g/mol. Its IUPAC name is 1,3-bis(2-chlorophenyl)-1,3-bis[4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)amino]-6-(4-methylpiperazin-1-yl)-3-pyridinyl]propan-2-one.
| Compound Name | 1,3-bis(2-chlorophenyl)-1,3-bis[4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)amino]-6-(4-methylpiperazin-1-yl)-3-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 142754266 |
| Molecular Formula | C43H46Cl2N14O5 |
| Molecular Weight | 909.84 g/mol |
| Exact Mass | 908.32 |
| IUPAC Name | 1,3-bis(2-chlorophenyl)-1,3-bis[4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)amino]-6-(4-methylpiperazin-1-yl)-3-pyridinyl]propan-2-one |
| SMILES | Cc1[nH]nc(Nc2cc(N3CCN(C)CC3)ncc2C(C(=O)C(c2ccccc2Cl)c2cnc(N3CCN(C)CC3)cc2Nc2n[nH]c(C)c2[N+](=O)[O-])c2ccccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C43H46Cl2N14O5/c1-25-39(58(61)62)42(52-50-25)48-33-21-35(56-17-13-54(3)14-18-56)46-23-29(33)37(27-9-5-7-11-31(27)44)41(60)38(28-10-6-8-12-32(28)45)30-24-47-36(57-19-15-55(4)16-20-57)22-34(30)49-43-40(59(63)64)26(2)51-53-43/h5-12,21-24,37-38H,13-20H2,1-4H3,(H2,46,48,50,52)(H2,47,49,51,53) |
| InChIKey | MQZUQEGDWNBWAW-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 223.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.84 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|