About 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane
6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane (PubChem CID 142754320) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane.
Molecular Properties
| Compound Name | 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane |
| PubChem CID | 142754320 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane |
| SMILES | c1nc(C2CC2)oc1CN1CCC2(CC1)CO2 |
| InChI | InChI=1S/C13H18N2O2/c1-2-10(1)12-14-7-11(17-12)8-15-5-3-13(4-6-15)9-16-13/h7,10H,1-6,8-9H2 |
| InChIKey | DXBJTWFXQLCTFP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane?
The IUPAC name of 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane (CID 142754320) is 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane.
What is the SMILES notation for 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane?
The canonical SMILES for 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane is c1nc(C2CC2)oc1CN1CCC2(CC1)CO2.
What is the InChIKey of 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane?
The InChIKey is DXBJTWFXQLCTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-2-10(1)12-14-7-11(17-12)8-15-5-3-13(4-6-15)9-16-13/h7,10H,1-6,8-9H2.
What are the key properties of 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane?
6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane has a molecular weight of 234.30 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-oxa-6-azaspiro[2.5]octane is sourced from PubChem (CID 142754320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).