C17H20F3NO2 — CID 142754357
(3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(2,2,2-trifluoroethyl)pent-4-en-1-one (PubChem CID 142754357) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is (3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(2,2,2-trifluoroethyl)pent-4-en-1-one.
| Compound Name | (3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(2,2,2-trifluoroethyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 142754357 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(2,2,2-trifluoroethyl)pent-4-en-1-one |
| SMILES | C=C(C)[C@H](CC(=O)N1COC[C@@H]1c1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C17H20F3NO2/c1-12(2)14(9-17(18,19)20)8-16(22)21-11-23-10-15(21)13-6-4-3-5-7-13/h3-7,14-15H,1,8-11H2,2H3/t14-,15-/m1/s1 |
| InChIKey | LDFAXEWJWCZTBK-HUUCEWRRSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|