C16H18F3NO2 — CID 142754369
(3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(trifluoromethyl)pent-4-en-1-one (PubChem CID 142754369) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is (3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(trifluoromethyl)pent-4-en-1-one.
| Compound Name | (3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(trifluoromethyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 142754369 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3R)-4-methyl-1-[(4S)-4-phenyl-1,3-oxazolidin-3-yl]-3-(trifluoromethyl)pent-4-en-1-one |
| SMILES | C=C(C)[C@@H](CC(=O)N1COC[C@@H]1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO2/c1-11(2)13(16(17,18)19)8-15(21)20-10-22-9-14(20)12-6-4-3-5-7-12/h3-7,13-14H,1,8-10H2,2H3/t13-,14-/m1/s1 |
| InChIKey | HTOALHPAGUJKIL-ZIAGYGMSSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|