C25H20F6N4O — CID 142754753
2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 142754753) has the molecular formula C25H20F6N4O and a molecular weight of 506.45 g/mol. Its IUPAC name is 2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 142754753 |
| Molecular Formula | C25H20F6N4O |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | C[C@]1(c2ccccc2)CN(c2ncc(C#N)cn2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20F6N4O/c1-22(18-5-3-2-4-6-18)15-35(21-33-12-16(11-32)13-34-21)14-20(22)17-7-9-19(10-8-17)23(36,24(26,27)28)25(29,30)31/h2-10,12-13,20,36H,14-15H2,1H3/t20-,22+/m0/s1 |
| InChIKey | VCAZGWYOAPAULB-RBBKRZOGSA-N |
| XLogP | 5.22 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |