C25H19F7N4O — CID 142754754
2-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 142754754) has the molecular formula C25H19F7N4O and a molecular weight of 524.44 g/mol. Its IUPAC name is 2-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 142754754 |
| Molecular Formula | C25H19F7N4O |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(c2ncc(C#N)cn2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H19F7N4O/c1-22(17-6-8-19(26)9-7-17)14-36(21-34-11-15(10-33)12-35-21)13-20(22)16-2-4-18(5-3-16)23(37,24(27,28)29)25(30,31)32/h2-9,11-12,20,37H,13-14H2,1H3/t20-,22+/m0/s1 |
| InChIKey | MOFUDAJTVIAWPZ-RBBKRZOGSA-N |
| XLogP | 5.36 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |