C26H22Cl2N4O3 — CID 142754781
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-methyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 142754781) has the molecular formula C26H22Cl2N4O3 and a molecular weight of 509.39 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-methyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-methyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142754781 |
| Molecular Formula | C26H22Cl2N4O3 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-methyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(C)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C26H22Cl2N4O3/c1-5-23(33)32-18-9-7-6-8-17(18)31-22-11-16-14(2)30-19(10-15(16)13-29-22)24-25(27)20(34-3)12-21(35-4)26(24)28/h5-13H,1H2,2-4H3,(H,29,31)(H,32,33) |
| InChIKey | BKZCLQWUBOUWAM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|