C13H13ClF2N2 — CID 142754812
(6R)-6-(3-chloro-2,6-difluorophenyl)-1-methyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole (PubChem CID 142754812) has the molecular formula C13H13ClF2N2 and a molecular weight of 270.71 g/mol. Its IUPAC name is (6R)-6-(3-chloro-2,6-difluorophenyl)-1-methyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole.
| Compound Name | (6R)-6-(3-chloro-2,6-difluorophenyl)-1-methyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 142754812 |
| Molecular Formula | C13H13ClF2N2 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (6R)-6-(3-chloro-2,6-difluorophenyl)-1-methyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole |
| SMILES | CC1=C2C[C@H](c3c(F)ccc(Cl)c3F)CN2CN1 |
| InChI | InChI=1S/C13H13ClF2N2/c1-7-11-4-8(5-18(11)6-17-7)12-10(15)3-2-9(14)13(12)16/h2-3,8,17H,4-6H2,1H3/t8-/m0/s1 |
| InChIKey | MKXJOACJFNLHES-QMMMGPOBSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|