C11H20O3 — CID 142754995
4-hydroxyoctyl prop-2-enoate (PubChem CID 142754995) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-hydroxyoctyl prop-2-enoate.
| Compound Name | 4-hydroxyoctyl prop-2-enoate |
|---|---|
| PubChem CID | 142754995 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 4-hydroxyoctyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(O)CCCC |
| InChI | InChI=1S/C11H20O3/c1-3-5-7-10(12)8-6-9-14-11(13)4-2/h4,10,12H,2-3,5-9H2,1H3 |
| InChIKey | WYNAJJWUAGHPPU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|