About 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole
5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole (PubChem CID 142755043) has the molecular formula C23H14N2O3
and a molecular weight of 366.38 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole.
Molecular Properties
| Compound Name | 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole |
| PubChem CID | 142755043 |
| Molecular Formula | C23H14N2O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2oc(-c3ccccc3)nc2c2ccccc12 |
| InChI | InChI=1S/C23H14N2O3/c26-25(27)20-13-7-6-11-17(20)19-14-21-22(18-12-5-4-10-16(18)19)24-23(28-21)15-8-2-1-3-9-15/h1-14H |
| InChIKey | UICUAQCDEMSUSD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole?
The IUPAC name of 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole (CID 142755043) is 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole.
What is the SMILES notation for 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole?
The canonical SMILES for 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole is O=[N+]([O-])c1ccccc1-c1cc2oc(-c3ccccc3)nc2c2ccccc12.
What is the InChIKey of 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole?
The InChIKey is UICUAQCDEMSUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14N2O3/c26-25(27)20-13-7-6-11-17(20)19-14-21-22(18-12-5-4-10-16(18)19)24-23(28-21)15-8-2-1-3-9-15/h1-14H.
What are the key properties of 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole?
5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole has a molecular weight of 366.38 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-nitrophenyl)-2-phenylbenzo[e][1,3]benzoxazole is sourced from PubChem (CID 142755043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).