C14H14Cl2FN5O — CID 142755060
1-[(3S,4R)-3-[(2,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4-fluoropiperidin-1-yl]prop-2-en-1-one (PubChem CID 142755060) has the molecular formula C14H14Cl2FN5O and a molecular weight of 358.20 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[(2,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4-fluoropiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S,4R)-3-[(2,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4-fluoropiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142755060 |
| Molecular Formula | C14H14Cl2FN5O |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-[(3S,4R)-3-[(2,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4-fluoropiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](F)[C@@H](Nc2nc(Cl)nc3[nH]cc(Cl)c23)C1 |
| InChI | InChI=1S/C14H14Cl2FN5O/c1-2-10(23)22-4-3-8(17)9(6-22)19-13-11-7(15)5-18-12(11)20-14(16)21-13/h2,5,8-9H,1,3-4,6H2,(H2,18,19,20,21)/t8-,9+/m1/s1 |
| InChIKey | MDPSCZJYLKPRQH-BDAKNGLRSA-N |
| XLogP | 2.80 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|