About methyl 5-methyl-2H-1,3-oxazole-3-carboxylate
methyl 5-methyl-2H-1,3-oxazole-3-carboxylate (PubChem CID 142755088) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is methyl 5-methyl-2H-1,3-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-2H-1,3-oxazole-3-carboxylate |
| PubChem CID | 142755088 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | methyl 5-methyl-2H-1,3-oxazole-3-carboxylate |
| SMILES | COC(=O)N1C=C(C)OC1 |
| InChI | InChI=1S/C6H9NO3/c1-5-3-7(4-10-5)6(8)9-2/h3H,4H2,1-2H3 |
| InChIKey | MYTGJLVMLCULRF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-methyl-2H-1,3-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-2H-1,3-oxazole-3-carboxylate?
The IUPAC name of methyl 5-methyl-2H-1,3-oxazole-3-carboxylate (CID 142755088) is methyl 5-methyl-2H-1,3-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-methyl-2H-1,3-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-methyl-2H-1,3-oxazole-3-carboxylate is COC(=O)N1C=C(C)OC1.
What is the InChIKey of methyl 5-methyl-2H-1,3-oxazole-3-carboxylate?
The InChIKey is MYTGJLVMLCULRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-5-3-7(4-10-5)6(8)9-2/h3H,4H2,1-2H3.
What are the key properties of methyl 5-methyl-2H-1,3-oxazole-3-carboxylate?
methyl 5-methyl-2H-1,3-oxazole-3-carboxylate has a molecular weight of 143.14 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-2H-1,3-oxazole-3-carboxylate is sourced from PubChem (CID 142755088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).