C14H14ClFN4O2 — CID 142755118
1-[(3R,4S)-3-[(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one (PubChem CID 142755118) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is 1-[(3R,4S)-3-[(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4S)-3-[(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142755118 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-[(3R,4S)-3-[(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-4-fluoropiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H](F)[C@H](Oc2nc(Cl)nc3[nH]ccc23)C1 |
| InChI | InChI=1S/C14H14ClFN4O2/c1-2-11(21)20-6-4-9(16)10(7-20)22-13-8-3-5-17-12(8)18-14(15)19-13/h2-3,5,9-10H,1,4,6-7H2,(H,17,18,19)/t9-,10+/m0/s1 |
| InChIKey | XHATWPDRXSNZKF-VHSXEESVSA-N |
| XLogP | 2.12 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|